MDL | MFCD00008716 |
---|---|
Molecular Weight | 218.20 |
Molecular Formula | C9H14O6 |
SMILES | CC(OCC(OC(C)=O)COC(C)=O)=O |
Triacetin is an artificial chemical compound, is the triester of glycerol and acetic acid, and is the second simplest fat after triformin.
Human Endogenous Metabolite |
Liquid
Room temperature in continental US; may vary elsewhere.
Pure form | -20°C | 3 years |
---|---|---|
4°C | 2 years | |
In solvent | -80°C | 6 months |
-20°C | 1 month |
DMSO : ≥ 2.3 mg/mL ( 10.54 mM )
* "≥" means soluble, but saturation unknown.
Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
---|
1 mM | 4.5830 mL | 22.9148 mL | 45.8295 mL |
5 mM | 0.9166 mL | 4.5830 mL | 9.1659 mL |
10 mM | 0.4583 mL | 2.2915 mL | 4.5830 mL |