MDL | MFCD14657401 |
---|---|
Molecular Weight | 223.18 |
Molecular Formula | C10H7F2N3O |
SMILES | O=C(C1=C(F)C=CC=C1F)NC2=NNC=C2 |
CRAC intermediate 1 is a key intermediate in the chemical synthesis of a series of CRAC channel inhibitors, detailed information can be found in Patent WO 2010122089 A1, intermediate 9.
Solid
Room temperature in continental US; may vary elsewhere.
Powder | -20°C | 3 years |
---|---|---|
4°C | 2 years | |
In solvent | -80°C | 6 months |
-20°C | 1 month |
DMSO : ≥ 50 mg/mL ( 224.03 mM )
* "≥" means soluble, but saturation unknown.
Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
---|
1 mM | 4.4807 mL | 22.4034 mL | 44.8069 mL |
5 mM | 0.8961 mL | 4.4807 mL | 8.9614 mL |
10 mM | 0.4481 mL | 2.2403 mL | 4.4807 mL |