MDL | MFCD00003033 |
---|---|
Molecular Weight | 250.19 |
Molecular Formula | C12H11O4P |
SMILES | O=P(OC1=CC=CC=C1)(OC2=CC=CC=C2)O |
Diphenyl Phosphate inhibits growth and energy metabolism of zebrafish in a sex-specific manner.
Solid
Room temperature in continental US; may vary elsewhere.
Powder | -20°C | 3 years |
---|---|---|
4°C | 2 years | |
In solvent | -80°C | 6 months |
-20°C | 1 month |
DMSO : ≥ 100 mg/mL ( 399.70 mM )
* "≥" means soluble, but saturation unknown.
Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
---|
1 mM | 3.9970 mL | 19.9848 mL | 39.9696 mL |
5 mM | 0.7994 mL | 3.9970 mL | 7.9939 mL |
10 mM | 0.3997 mL | 1.9985 mL | 3.9970 mL |