MDL | MFCD14918065 |
---|---|
Molecular Weight | 461.53 |
Molecular Formula | C25H23N3O4S |
SMILES | O=C(NCC1=CC=CN=C1)C2=CC=C(C3=NC(CS(=O)(C4=CC=C(C)C=C4)=O)=C(C)O3)C=C2 |
STF-118804 is a highly specific NAMPT inhibitor; reduces the viability of most B-ALL cell lines with IC 50 <10 nM.
Solid
Room temperature in continental US; may vary elsewhere.
Powder | -20°C | 3 years |
---|---|---|
4°C | 2 years | |
In solvent | -80°C | 6 months |
-20°C | 1 month |
DMSO : ≥ 31 mg/mL ( 67.17 mM )
* "≥" means soluble, but saturation unknown.
Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
---|
1 mM | 2.1667 mL | 10.8335 mL | 21.6671 mL |
5 mM | 0.4333 mL | 2.1667 mL | 4.3334 mL |
10 mM | 0.2167 mL | 1.0834 mL | 2.1667 mL |