MDL | - |
---|---|
Molecular Weight | 569.63 |
Molecular Formula | C28H31N3O8S |
SMILES | O=C(C(C(C)=C(C1=NC=CO1)S2)=C2N3C[C@@H](OC4CCOCC4)C5=C(OC)C=CC=C5)N(C(C)(C)C(O)=O)C3=O |
Firsocostat S enantiomer (ND-630 S enantiomer) is the less active S enantiomer of Firsocostat. Firsocostat is an acetyl-CoA carboxylase ( ACC ) inhibitor.
Solid
Room temperature in continental US; may vary elsewhere.
Powder | -20°C | 3 years |
---|---|---|
4°C | 2 years | |
In solvent | -80°C | 6 months |
-20°C | 1 month |
DMSO : ≥ 50 mg/mL ( 87.78 mM )
* "≥" means soluble, but saturation unknown.
Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
---|
1 mM | 1.7555 mL | 8.7776 mL | 17.5553 mL |
5 mM | 0.3511 mL | 1.7555 mL | 3.5111 mL |
10 mM | 0.1756 mL | 0.8778 mL | 1.7555 mL |